About 3-(azidomethyl)-2,4,6-trimethylphenol
3-(azidomethyl)-2,4,6-trimethylphenol (PubChem CID 151948155) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-(azidomethyl)-2,4,6-trimethylphenol.
Molecular Properties
| Compound Name | 3-(azidomethyl)-2,4,6-trimethylphenol |
| PubChem CID | 151948155 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 3-(azidomethyl)-2,4,6-trimethylphenol |
| SMILES | Cc1cc(C)c(CN=[N+]=[N-])c(C)c1O |
| InChI | InChI=1S/C10H13N3O/c1-6-4-7(2)10(14)8(3)9(6)5-12-13-11/h4,14H,5H2,1-3H3 |
| InChIKey | TWBOKTOZKCEMJB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(azidomethyl)-2,4,6-trimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azidomethyl)-2,4,6-trimethylphenol?
The IUPAC name of 3-(azidomethyl)-2,4,6-trimethylphenol (CID 151948155) is 3-(azidomethyl)-2,4,6-trimethylphenol.
What is the SMILES notation for 3-(azidomethyl)-2,4,6-trimethylphenol?
The canonical SMILES for 3-(azidomethyl)-2,4,6-trimethylphenol is Cc1cc(C)c(CN=[N+]=[N-])c(C)c1O.
What is the InChIKey of 3-(azidomethyl)-2,4,6-trimethylphenol?
The InChIKey is TWBOKTOZKCEMJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-6-4-7(2)10(14)8(3)9(6)5-12-13-11/h4,14H,5H2,1-3H3.
What are the key properties of 3-(azidomethyl)-2,4,6-trimethylphenol?
3-(azidomethyl)-2,4,6-trimethylphenol has a molecular weight of 191.23 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azidomethyl)-2,4,6-trimethylphenol is sourced from PubChem (CID 151948155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).