About [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol
[(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol (PubChem CID 151950771) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol |
| PubChem CID | 151950771 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol |
| SMILES | NCC[C@@]1(CO)C=CC=CC1 |
| InChI | InChI=1S/C9H15NO/c10-7-6-9(8-11)4-2-1-3-5-9/h1-4,11H,5-8,10H2/t9-/m1/s1 |
| InChIKey | TWPGQJVNIXXBNN-SECBINFHSA-N |
| XLogP | 0.83 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol?
The IUPAC name of [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol (CID 151950771) is [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol.
What is the SMILES notation for [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol?
The canonical SMILES for [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol is NCC[C@@]1(CO)C=CC=CC1.
What is the InChIKey of [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol?
The InChIKey is TWPGQJVNIXXBNN-SECBINFHSA-N. The full InChI is InChI=1S/C9H15NO/c10-7-6-9(8-11)4-2-1-3-5-9/h1-4,11H,5-8,10H2/t9-/m1/s1.
What are the key properties of [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol?
[(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol has a molecular weight of 153.22 g/mol, XLogP of 0.83, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-(2-aminoethyl)cyclohexa-2,4-dien-1-yl]methanol is sourced from PubChem (CID 151950771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).