About bis(1,3-dithian-2-yl)methanol
bis(1,3-dithian-2-yl)methanol (PubChem CID 15195213) has the molecular formula C9H16OS4
and a molecular weight of 268.49 g/mol. Its IUPAC name is bis(1,3-dithian-2-yl)methanol.
Molecular Properties
| Compound Name | bis(1,3-dithian-2-yl)methanol |
| PubChem CID | 15195213 |
| Molecular Formula | C9H16OS4 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | bis(1,3-dithian-2-yl)methanol |
| SMILES | OC(C1SCCCS1)C1SCCCS1 |
| InChI | InChI=1S/C9H16OS4/c10-7(8-11-3-1-4-12-8)9-13-5-2-6-14-9/h7-10H,1-6H2 |
| InChIKey | OTMFAGHPNGDYKW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(1,3-dithian-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,3-dithian-2-yl)methanol?
The IUPAC name of bis(1,3-dithian-2-yl)methanol (CID 15195213) is bis(1,3-dithian-2-yl)methanol.
What is the SMILES notation for bis(1,3-dithian-2-yl)methanol?
The canonical SMILES for bis(1,3-dithian-2-yl)methanol is OC(C1SCCCS1)C1SCCCS1.
What is the InChIKey of bis(1,3-dithian-2-yl)methanol?
The InChIKey is OTMFAGHPNGDYKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS4/c10-7(8-11-3-1-4-12-8)9-13-5-2-6-14-9/h7-10H,1-6H2.
What are the key properties of bis(1,3-dithian-2-yl)methanol?
bis(1,3-dithian-2-yl)methanol has a molecular weight of 268.49 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,3-dithian-2-yl)methanol is sourced from PubChem (CID 15195213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).