C23H20ClN3 — CID 15195251
16,16-bis(1H-pyrrol-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride (PubChem CID 15195251) has the molecular formula C23H20ClN3 and a molecular weight of 373.89 g/mol. Its IUPAC name is 16,16-bis(1H-pyrrol-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride.
| Compound Name | 16,16-bis(1H-pyrrol-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride |
|---|---|
| PubChem CID | 15195251 |
| Molecular Formula | C23H20ClN3 |
| Molecular Weight | 373.89 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 16,16-bis(1H-pyrrol-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride |
| SMILES | [Cl-].c1ccc2c(c1)C1CC(c3cc[nH]c3)(c3cc[nH]c3)C2c2cccc[n+]21 |
| InChI | InChI=1S/C23H20N3.ClH/c1-2-6-19-18(5-1)21-13-23(16-8-10-24-14-16,17-9-11-25-15-17)22(19)20-7-3-4-12-26(20)21;/h1-12,14-15,21-22,24-25H,13H2;1H/q+1;/p-1 |
| InChIKey | ADCFKKOLMIUWMI-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 35.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.89 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|