C21H18N5+ — CID 15195254
16,16-bis(1H-pyrazol-5-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene (PubChem CID 15195254) has the molecular formula C21H18N5+ and a molecular weight of 340.41 g/mol. Its IUPAC name is 16,16-bis(1H-pyrazol-5-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene.
| Compound Name | 16,16-bis(1H-pyrazol-5-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 15195254 |
| Molecular Formula | C21H18N5+ |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 16,16-bis(1H-pyrazol-5-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
| SMILES | c1ccc2c(c1)C1CC(c3ccn[nH]3)(c3ccn[nH]3)C2c2cccc[n+]21 |
| InChI | InChI=1S/C21H18N5/c1-2-6-15-14(5-1)17-13-21(18-8-10-22-24-18,19-9-11-23-25-19)20(15)16-7-3-4-12-26(16)17/h1-12,17,20H,13H2,(H,22,24)(H,23,25)/q+1 |
| InChIKey | IVOFFAKJHVLAMO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|