About 2-fluoro-3-methyl-2H-1,4-benzoxazine
2-fluoro-3-methyl-2H-1,4-benzoxazine (PubChem CID 151953033) has the molecular formula C9H8FNO
and a molecular weight of 165.17 g/mol. Its IUPAC name is 2-fluoro-3-methyl-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 2-fluoro-3-methyl-2H-1,4-benzoxazine |
| PubChem CID | 151953033 |
| Molecular Formula | C9H8FNO |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2-fluoro-3-methyl-2H-1,4-benzoxazine |
| SMILES | CC1=Nc2ccccc2OC1F |
| InChI | InChI=1S/C9H8FNO/c1-6-9(10)12-8-5-3-2-4-7(8)11-6/h2-5,9H,1H3 |
| InChIKey | TXBIWDIRZOASFC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-3-methyl-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-methyl-2H-1,4-benzoxazine?
The IUPAC name of 2-fluoro-3-methyl-2H-1,4-benzoxazine (CID 151953033) is 2-fluoro-3-methyl-2H-1,4-benzoxazine.
What is the SMILES notation for 2-fluoro-3-methyl-2H-1,4-benzoxazine?
The canonical SMILES for 2-fluoro-3-methyl-2H-1,4-benzoxazine is CC1=Nc2ccccc2OC1F.
What is the InChIKey of 2-fluoro-3-methyl-2H-1,4-benzoxazine?
The InChIKey is TXBIWDIRZOASFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO/c1-6-9(10)12-8-5-3-2-4-7(8)11-6/h2-5,9H,1H3.
What are the key properties of 2-fluoro-3-methyl-2H-1,4-benzoxazine?
2-fluoro-3-methyl-2H-1,4-benzoxazine has a molecular weight of 165.17 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-methyl-2H-1,4-benzoxazine is sourced from PubChem (CID 151953033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).