C25H23N3O — CID 151953463
N-(8-methoxy-2-methylquinolin-4-yl)-N,9-dimethylcarbazol-3-amine (PubChem CID 151953463) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(8-methoxy-2-methylquinolin-4-yl)-N,9-dimethylcarbazol-3-amine.
| Compound Name | N-(8-methoxy-2-methylquinolin-4-yl)-N,9-dimethylcarbazol-3-amine |
|---|---|
| PubChem CID | 151953463 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-(8-methoxy-2-methylquinolin-4-yl)-N,9-dimethylcarbazol-3-amine |
| SMILES | COc1cccc2c(N(C)c3ccc4c(c3)c3ccccc3n4C)cc(C)nc12 |
| InChI | InChI=1S/C25H23N3O/c1-16-14-23(19-9-7-11-24(29-4)25(19)26-16)27(2)17-12-13-22-20(15-17)18-8-5-6-10-21(18)28(22)3/h5-15H,1-4H3 |
| InChIKey | TXDKNOQEFIRGMM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |