C23H32BFO5 — CID 151956448
tert-butyl 6-fluoro-2-methoxy-3-[[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate (PubChem CID 151956448) has the molecular formula C23H32BFO5 and a molecular weight of 418.31 g/mol. Its IUPAC name is tert-butyl 6-fluoro-2-methoxy-3-[[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate.
| Compound Name | tert-butyl 6-fluoro-2-methoxy-3-[[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate |
|---|---|
| PubChem CID | 151956448 |
| Molecular Formula | C23H32BFO5 |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | tert-butyl 6-fluoro-2-methoxy-3-[[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate |
| SMILES | COc1c(CB2OC3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)ccc(F)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H32BFO5/c1-21(2,3)28-20(26)18-15(25)9-8-13(19(18)27-7)12-24-29-17-11-14-10-16(22(14,4)5)23(17,6)30-24/h8-9,14,16-17H,10-12H2,1-7H3/t14-,16-,17?,23-/m0/s1 |
| InChIKey | TXSWGUBIHWJSEN-XLFNVVOESA-N |
| XLogP | 4.60 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|