About 1,5-dipropylcyclopentene
1,5-dipropylcyclopentene (PubChem CID 151956765) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is 1,5-dipropylcyclopentene.
Molecular Properties
| Compound Name | 1,5-dipropylcyclopentene |
| PubChem CID | 151956765 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 1,5-dipropylcyclopentene |
| SMILES | CCCC1=CCCC1CCC |
| InChI | InChI=1S/C11H20/c1-3-6-10-8-5-9-11(10)7-4-2/h8,11H,3-7,9H2,1-2H3 |
| InChIKey | TXUOUZFKUGZUQA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dipropylcyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dipropylcyclopentene?
The IUPAC name of 1,5-dipropylcyclopentene (CID 151956765) is 1,5-dipropylcyclopentene.
What is the SMILES notation for 1,5-dipropylcyclopentene?
The canonical SMILES for 1,5-dipropylcyclopentene is CCCC1=CCCC1CCC.
What is the InChIKey of 1,5-dipropylcyclopentene?
The InChIKey is TXUOUZFKUGZUQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20/c1-3-6-10-8-5-9-11(10)7-4-2/h8,11H,3-7,9H2,1-2H3.
What are the key properties of 1,5-dipropylcyclopentene?
1,5-dipropylcyclopentene has a molecular weight of 152.28 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dipropylcyclopentene is sourced from PubChem (CID 151956765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).