C27H30BF3O7 — CID 151957761
ethyl 2-[4-methoxy-2-[[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 151957761) has the molecular formula C27H30BF3O7 and a molecular weight of 534.34 g/mol. Its IUPAC name is ethyl 2-[4-methoxy-2-[[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[4-methoxy-2-[[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 151957761 |
| Molecular Formula | C27H30BF3O7 |
| Molecular Weight | 534.34 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | ethyl 2-[4-methoxy-2-[[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC)cc1OCc1cc(B2OC(C)(C)C(C)(C)O2)c2occ(C(F)(F)F)c2c1 |
| InChI | InChI=1S/C27H30BF3O7/c1-7-34-23(32)12-17-8-9-18(33-6)13-22(17)35-14-16-10-19-20(27(29,30)31)15-36-24(19)21(11-16)28-37-25(2,3)26(4,5)38-28/h8-11,13,15H,7,12,14H2,1-6H3 |
| InChIKey | TXZPFDGGBGWHMP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.34 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|