C18H22N4+2 — CID 15195906
6,11-diaza-3,14-diazoniatetracyclo[14.2.2.13,6.111,14]docosa-1(18),3(22),4,12,14(21),16,19-heptaene (PubChem CID 15195906) has the molecular formula C18H22N4+2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 6,11-diaza-3,14-diazoniatetracyclo[14.2.2.13,6.111,14]docosa-1(18),3(22),4,12,14(21),16,19-heptaene.
| Compound Name | 6,11-diaza-3,14-diazoniatetracyclo[14.2.2.13,6.111,14]docosa-1(18),3(22),4,12,14(21),16,19-heptaene |
|---|---|
| PubChem CID | 15195906 |
| Molecular Formula | C18H22N4+2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 6,11-diaza-3,14-diazoniatetracyclo[14.2.2.13,6.111,14]docosa-1(18),3(22),4,12,14(21),16,19-heptaene |
| SMILES | c1cc2ccc1C[n+]1ccn(c1)CCCCn1cc[n+](c1)C2 |
| InChI | InChI=1S/C18H22N4/c1-2-8-20-10-12-22(16-20)14-18-5-3-17(4-6-18)13-21-11-9-19(7-1)15-21/h3-6,9-12,15-16H,1-2,7-8,13-14H2/q+2 |
| InChIKey | DFOORHMQSJULKF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|