About trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane
trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane (PubChem CID 15196655) has the molecular formula C22H44Si4
and a molecular weight of 420.94 g/mol. Its IUPAC name is trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane.
Molecular Properties
| Compound Name | trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane |
| PubChem CID | 15196655 |
| Molecular Formula | C22H44Si4 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane |
| SMILES | C[Si](C)(C)C=C1CC(=C[Si](C)(C)C)C(=C[Si](C)(C)C)CC1=C[Si](C)(C)C |
| InChI | InChI=1S/C22H44Si4/c1-23(2,3)15-19-13-21(17-25(7,8)9)22(18-26(10,11)12)14-20(19)16-24(4,5)6/h15-18H,13-14H2,1-12H3 |
| InChIKey | BRKSFNJSVFTYGB-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane?
The IUPAC name of trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane (CID 15196655) is trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane.
What is the SMILES notation for trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane?
The canonical SMILES for trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane is C[Si](C)(C)C=C1CC(=C[Si](C)(C)C)C(=C[Si](C)(C)C)CC1=C[Si](C)(C)C.
What is the InChIKey of trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane?
The InChIKey is BRKSFNJSVFTYGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44Si4/c1-23(2,3)15-19-13-21(17-25(7,8)9)22(18-26(10,11)12)14-20(19)16-24(4,5)6/h15-18H,13-14H2,1-12H3.
What are the key properties of trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane?
trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane has a molecular weight of 420.94 g/mol, XLogP of 8.00, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[[2,4,5-tris(trimethylsilylmethylidene)cyclohexylidene]methyl]silane is sourced from PubChem (CID 15196655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).