C14H18N4O4 — CID 151968624
11-hydroxy-4,7-dimethyl-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide (PubChem CID 151968624) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 11-hydroxy-4,7-dimethyl-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | 11-hydroxy-4,7-dimethyl-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 151968624 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 11-hydroxy-4,7-dimethyl-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
| SMILES | CC1CCN(C)C2Cn3cc(C(N)=O)c(=O)c(O)c3C(=O)N12 |
| InChI | InChI=1S/C14H18N4O4/c1-7-3-4-16(2)9-6-17-5-8(13(15)21)11(19)12(20)10(17)14(22)18(7)9/h5,7,9,20H,3-4,6H2,1-2H3,(H2,15,21) |
| InChIKey | UAEQOHPYIQJYIF-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |