C12H15NO2 — CID 15197117
(4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol (PubChem CID 15197117) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol.
| Compound Name | (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol |
|---|---|
| PubChem CID | 15197117 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol |
| SMILES | CC1(C)C(c2ccccc2)=NOC1CO |
| InChI | InChI=1S/C12H15NO2/c1-12(2)10(8-14)15-13-11(12)9-6-4-3-5-7-9/h3-7,10,14H,8H2,1-2H3 |
| InChIKey | OTXBKLUXNKYODP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |