About (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol
(4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol (PubChem CID 15197117) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol.
Molecular Properties
| Compound Name | (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol |
| PubChem CID | 15197117 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol |
| SMILES | CC1(C)C(c2ccccc2)=NOC1CO |
| InChI | InChI=1S/C12H15NO2/c1-12(2)10(8-14)15-13-11(12)9-6-4-3-5-7-9/h3-7,10,14H,8H2,1-2H3 |
| InChIKey | OTXBKLUXNKYODP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol?
The IUPAC name of (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol (CID 15197117) is (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol.
What is the SMILES notation for (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol?
The canonical SMILES for (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol is CC1(C)C(c2ccccc2)=NOC1CO.
What is the InChIKey of (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol?
The InChIKey is OTXBKLUXNKYODP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-12(2)10(8-14)15-13-11(12)9-6-4-3-5-7-9/h3-7,10,14H,8H2,1-2H3.
What are the key properties of (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol?
(4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol has a molecular weight of 205.26 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-3-phenyl-5H-1,2-oxazol-5-yl)methanol is sourced from PubChem (CID 15197117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).