C19H21NO5S — CID 15197576
benzyl (3R)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate (PubChem CID 15197576) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is benzyl (3R)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | benzyl (3R)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15197576 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | benzyl (3R)-3-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CCN(C(=O)OCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H21NO5S/c1-15-7-9-18(10-8-15)26(22,23)25-17-11-12-20(13-17)19(21)24-14-16-5-3-2-4-6-16/h2-10,17H,11-14H2,1H3/t17-/m1/s1 |
| InChIKey | SMCDOKNEALHLNF-QGZVFWFLSA-N |
| XLogP | 3.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|