C16H16N10O — CID 151976278
1-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]-3-(7H-purin-2-yl)urea (PubChem CID 151976278) has the molecular formula C16H16N10O and a molecular weight of 364.37 g/mol. Its IUPAC name is 1-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]-3-(7H-purin-2-yl)urea.
| Compound Name | 1-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]-3-(7H-purin-2-yl)urea |
|---|---|
| PubChem CID | 151976278 |
| Molecular Formula | C16H16N10O |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]-3-(7H-purin-2-yl)urea |
| SMILES | CC(C)n1cnnc1-c1cccc(NC(=O)Nc2ncc3[nH]cnc3n2)n1 |
| InChI | InChI=1S/C16H16N10O/c1-9(2)26-8-20-25-14(26)10-4-3-5-12(21-10)22-16(27)24-15-17-6-11-13(23-15)19-7-18-11/h3-9H,1-2H3,(H3,17,18,19,21,22,23,24,27) |
| InChIKey | UBSRPCYTKJDJKN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |