C28H18N4 — CID 15197828
1,8-diphenyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9,9,10,10-tetracarbonitrile (PubChem CID 15197828) has the molecular formula C28H18N4 and a molecular weight of 410.48 g/mol. Its IUPAC name is 1,8-diphenyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9,9,10,10-tetracarbonitrile.
| Compound Name | 1,8-diphenyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9,9,10,10-tetracarbonitrile |
|---|---|
| PubChem CID | 15197828 |
| Molecular Formula | C28H18N4 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1,8-diphenyltricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9,9,10,10-tetracarbonitrile |
| SMILES | N#CC1(C#N)C2(c3ccccc3)CCC(c3ccccc3)(c3ccccc32)C1(C#N)C#N |
| InChI | InChI=1S/C28H18N4/c29-17-25(18-30)26(19-31,20-32)28(22-11-5-2-6-12-22)16-15-27(25,21-9-3-1-4-10-21)23-13-7-8-14-24(23)28/h1-14H,15-16H2 |
| InChIKey | ZZPJQHCXPMKSNW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|