About 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide
4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide (PubChem CID 151978529) has the molecular formula C19H15Cl3N2O3S2
and a molecular weight of 489.83 g/mol. Its IUPAC name is 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide |
| PubChem CID | 151978529 |
| Molecular Formula | C19H15Cl3N2O3S2 |
| Molecular Weight | 489.83 g/mol |
| Exact Mass | 487.96 |
| IUPAC Name | 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)N(c2ccccc2)S(=O)C(Cl)(Cl)Cl)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H15Cl3N2O3S2/c20-19(21,22)28(25)24(16-9-5-2-6-10-16)29(26,27)18-12-11-15(23)13-17(18)14-7-3-1-4-8-14/h1-13H,23H2 |
| InChIKey | UCEFOTOFZKTFLC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.83 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide?
The IUPAC name of 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide (CID 151978529) is 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide.
What is the SMILES notation for 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide?
The canonical SMILES for 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide is Nc1ccc(S(=O)(=O)N(c2ccccc2)S(=O)C(Cl)(Cl)Cl)c(-c2ccccc2)c1.
What is the InChIKey of 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide?
The InChIKey is UCEFOTOFZKTFLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl3N2O3S2/c20-19(21,22)28(25)24(16-9-5-2-6-10-16)29(26,27)18-12-11-15(23)13-17(18)14-7-3-1-4-8-14/h1-13H,23H2.
What are the key properties of 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide?
4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide has a molecular weight of 489.83 g/mol, XLogP of 5.12, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,2-diphenyl-N-(trichloromethylsulfinyl)benzenesulfonamide is sourced from PubChem (CID 151978529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).