C29H50O3 — CID 151978690
octan-3-yl 3-(3,5-dibutyl-2-tert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 151978690) has the molecular formula C29H50O3 and a molecular weight of 446.72 g/mol. Its IUPAC name is octan-3-yl 3-(3,5-dibutyl-2-tert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | octan-3-yl 3-(3,5-dibutyl-2-tert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 151978690 |
| Molecular Formula | C29H50O3 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.38 |
| IUPAC Name | octan-3-yl 3-(3,5-dibutyl-2-tert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CCCCCC(CC)OC(=O)CCc1cc(CCCC)c(O)c(CCCC)c1C(C)(C)C |
| InChI | InChI=1S/C29H50O3/c1-8-12-15-17-24(11-4)32-26(30)20-19-22-21-23(16-13-9-2)28(31)25(18-14-10-3)27(22)29(5,6)7/h21,24,31H,8-20H2,1-7H3 |
| InChIKey | UCFBEQBFFMNURL-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|