C22H24F3NO6S — CID 151983150
tert-butyl 7-phenylmethoxy-6-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 151983150) has the molecular formula C22H24F3NO6S and a molecular weight of 487.50 g/mol. Its IUPAC name is tert-butyl 7-phenylmethoxy-6-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 7-phenylmethoxy-6-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 151983150 |
| Molecular Formula | C22H24F3NO6S |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | tert-butyl 7-phenylmethoxy-6-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(OS(=O)(=O)C(F)(F)F)c(OCc3ccccc3)cc2C1 |
| InChI | InChI=1S/C22H24F3NO6S/c1-21(2,3)31-20(27)26-10-9-16-11-19(32-33(28,29)22(23,24)25)18(12-17(16)13-26)30-14-15-7-5-4-6-8-15/h4-8,11-12H,9-10,13-14H2,1-3H3 |
| InChIKey | UDCSVCALBKKUKP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|