About phthalazine-1-sulfonic acid
phthalazine-1-sulfonic acid (PubChem CID 151983836) has the molecular formula C8H6N2O3S
and a molecular weight of 210.21 g/mol. Its IUPAC name is phthalazine-1-sulfonic acid.
Molecular Properties
| Compound Name | phthalazine-1-sulfonic acid |
| PubChem CID | 151983836 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | phthalazine-1-sulfonic acid |
| SMILES | O=S(=O)(O)c1nncc2ccccc12 |
| InChI | InChI=1S/C8H6N2O3S/c11-14(12,13)8-7-4-2-1-3-6(7)5-9-10-8/h1-5H,(H,11,12,13) |
| InChIKey | UDGFHBAAXPEYQZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze phthalazine-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalazine-1-sulfonic acid?
The IUPAC name of phthalazine-1-sulfonic acid (CID 151983836) is phthalazine-1-sulfonic acid.
What is the SMILES notation for phthalazine-1-sulfonic acid?
The canonical SMILES for phthalazine-1-sulfonic acid is O=S(=O)(O)c1nncc2ccccc12.
What is the InChIKey of phthalazine-1-sulfonic acid?
The InChIKey is UDGFHBAAXPEYQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3S/c11-14(12,13)8-7-4-2-1-3-6(7)5-9-10-8/h1-5H,(H,11,12,13).
What are the key properties of phthalazine-1-sulfonic acid?
phthalazine-1-sulfonic acid has a molecular weight of 210.21 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phthalazine-1-sulfonic acid is sourced from PubChem (CID 151983836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).