C15H34N4 — CID 15198794
1,4,8,12-tetramethyl-1,4,8,12-tetrazacyclopentadecane (PubChem CID 15198794) has the molecular formula C15H34N4 and a molecular weight of 270.46 g/mol. Its IUPAC name is 1,4,8,12-tetramethyl-1,4,8,12-tetrazacyclopentadecane.
| Compound Name | 1,4,8,12-tetramethyl-1,4,8,12-tetrazacyclopentadecane |
|---|---|
| PubChem CID | 15198794 |
| Molecular Formula | C15H34N4 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.28 |
| IUPAC Name | 1,4,8,12-tetramethyl-1,4,8,12-tetrazacyclopentadecane |
| SMILES | CN1CCCN(C)CCCN(C)CCN(C)CCC1 |
| InChI | InChI=1S/C15H34N4/c1-16-8-5-9-17(2)11-7-13-19(4)15-14-18(3)12-6-10-16/h5-15H2,1-4H3 |
| InChIKey | OABQWLAKKVQVQP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |