About 2-methylcyclobutan-1-one
2-methylcyclobutan-1-one (PubChem CID 15199) has the molecular formula C5H8O
and a molecular weight of 84.12 g/mol. Its IUPAC name is 2-methylcyclobutan-1-one.
Molecular Properties
| Compound Name | 2-methylcyclobutan-1-one |
| PubChem CID | 15199 |
| Molecular Formula | C5H8O |
| Molecular Weight | 84.12 g/mol |
| Exact Mass | 84.06 |
| IUPAC Name | 2-methylcyclobutan-1-one |
| SMILES | CC1CCC1=O |
| InChI | InChI=1S/C5H8O/c1-4-2-3-5(4)6/h4H,2-3H2,1H3 |
| InChIKey | YQENJRQBTHILBT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.12 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylcyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylcyclobutan-1-one?
The IUPAC name of 2-methylcyclobutan-1-one (CID 15199) is 2-methylcyclobutan-1-one.
What is the SMILES notation for 2-methylcyclobutan-1-one?
The canonical SMILES for 2-methylcyclobutan-1-one is CC1CCC1=O.
What is the InChIKey of 2-methylcyclobutan-1-one?
The InChIKey is YQENJRQBTHILBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O/c1-4-2-3-5(4)6/h4H,2-3H2,1H3.
What are the key properties of 2-methylcyclobutan-1-one?
2-methylcyclobutan-1-one has a molecular weight of 84.12 g/mol, XLogP of 0.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylcyclobutan-1-one is sourced from PubChem (CID 15199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).