C18H16I2S2 — CID 15199166
[(1E,3E)-4-benzylsulfanyl-1,4-diiodobuta-1,3-dienyl]sulfanylmethylbenzene (PubChem CID 15199166) has the molecular formula C18H16I2S2 and a molecular weight of 550.27 g/mol. Its IUPAC name is [(1E,3E)-4-benzylsulfanyl-1,4-diiodobuta-1,3-dienyl]sulfanylmethylbenzene.
| Compound Name | [(1E,3E)-4-benzylsulfanyl-1,4-diiodobuta-1,3-dienyl]sulfanylmethylbenzene |
|---|---|
| PubChem CID | 15199166 |
| Molecular Formula | C18H16I2S2 |
| Molecular Weight | 550.27 g/mol |
| Exact Mass | 549.88 |
| IUPAC Name | [(1E,3E)-4-benzylsulfanyl-1,4-diiodobuta-1,3-dienyl]sulfanylmethylbenzene |
| SMILES | I/C(=C/C=C(/I)SCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C18H16I2S2/c19-17(21-13-15-7-3-1-4-8-15)11-12-18(20)22-14-16-9-5-2-6-10-16/h1-12H,13-14H2/b17-11-,18-12- |
| InChIKey | QYWZPWCCFSUOQV-WHYMJUELSA-N |
| XLogP | 7.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.27 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|