About 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine
5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine (PubChem CID 151996850) has the molecular formula C15H18N4O3
and a molecular weight of 302.33 g/mol. Its IUPAC name is 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 151996850 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine |
| SMILES | CCOCC1=C(/N=N/c2ccccc2)C=CC(N)([N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H18N4O3/c1-2-22-11-12-10-15(16,19(20)21)9-8-14(12)18-17-13-6-4-3-5-7-13/h3-9H,2,10-11,16H2,1H3/b18-17+ |
| InChIKey | UFVXDAPORPSSOC-ISLYRVAYSA-N |
| XLogP | 2.95 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine (CID 151996850) is 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine is CCOCC1=C(/N=N/c2ccccc2)C=CC(N)([N+](=O)[O-])C1.
What is the InChIKey of 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine?
The InChIKey is UFVXDAPORPSSOC-ISLYRVAYSA-N. The full InChI is InChI=1S/C15H18N4O3/c1-2-22-11-12-10-15(16,19(20)21)9-8-14(12)18-17-13-6-4-3-5-7-13/h3-9H,2,10-11,16H2,1H3/b18-17+.
What are the key properties of 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine?
5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine has a molecular weight of 302.33 g/mol, XLogP of 2.95, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethoxymethyl)-1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 151996850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).