About 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine
4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine (PubChem CID 151998040) has the molecular formula C20H27NO
and a molecular weight of 297.44 g/mol. Its IUPAC name is 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine.
Molecular Properties
| Compound Name | 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine |
| PubChem CID | 151998040 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine |
| SMILES | Cc1ccc(CC2C(N3CCOCC3)=CC=CC2C)cc1C |
| InChI | InChI=1S/C20H27NO/c1-15-7-8-18(13-17(15)3)14-19-16(2)5-4-6-20(19)21-9-11-22-12-10-21/h4-8,13,16,19H,9-12,14H2,1-3H3 |
| InChIKey | UGCAYZUOCSWNEY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine?
The IUPAC name of 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine (CID 151998040) is 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine.
What is the SMILES notation for 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine?
The canonical SMILES for 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine is Cc1ccc(CC2C(N3CCOCC3)=CC=CC2C)cc1C.
What is the InChIKey of 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine?
The InChIKey is UGCAYZUOCSWNEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO/c1-15-7-8-18(13-17(15)3)14-19-16(2)5-4-6-20(19)21-9-11-22-12-10-21/h4-8,13,16,19H,9-12,14H2,1-3H3.
What are the key properties of 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine?
4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine has a molecular weight of 297.44 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-[(3,4-dimethylphenyl)methyl]-5-methylcyclohexa-1,3-dien-1-yl]morpholine is sourced from PubChem (CID 151998040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).