C14H22O5 — CID 15199888
10-hydroxy-1,2,5,7,9-pentamethyl-3,11,12-trioxatricyclo[5.3.1.12,6]dodecan-4-one (PubChem CID 15199888) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is 10-hydroxy-1,2,5,7,9-pentamethyl-3,11,12-trioxatricyclo[5.3.1.12,6]dodecan-4-one.
| Compound Name | 10-hydroxy-1,2,5,7,9-pentamethyl-3,11,12-trioxatricyclo[5.3.1.12,6]dodecan-4-one |
|---|---|
| PubChem CID | 15199888 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 10-hydroxy-1,2,5,7,9-pentamethyl-3,11,12-trioxatricyclo[5.3.1.12,6]dodecan-4-one |
| SMILES | CC1CC2(C)OC(C)(C1O)C1(C)OC(=O)C(C)C2O1 |
| InChI | InChI=1S/C14H22O5/c1-7-6-12(3)10-8(2)11(16)18-14(5,17-10)13(4,19-12)9(7)15/h7-10,15H,6H2,1-5H3 |
| InChIKey | AMZPOLFWIKSMLX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |