C21H26O4 — CID 15200478
[(1R,2S,8aS)-7-hydroxy-1,8a-dimethyl-6-oxo-1,2-dihydronaphthalen-2-yl] (2E,4E,6S)-6-methylocta-2,4-dienoate (PubChem CID 15200478) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is [(1R,2S,8aS)-7-hydroxy-1,8a-dimethyl-6-oxo-1,2-dihydronaphthalen-2-yl] (2E,4E,6S)-6-methylocta-2,4-dienoate.
| Compound Name | [(1R,2S,8aS)-7-hydroxy-1,8a-dimethyl-6-oxo-1,2-dihydronaphthalen-2-yl] (2E,4E,6S)-6-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 15200478 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [(1R,2S,8aS)-7-hydroxy-1,8a-dimethyl-6-oxo-1,2-dihydronaphthalen-2-yl] (2E,4E,6S)-6-methylocta-2,4-dienoate |
| SMILES | CC[C@H](C)/C=C/C=C/C(=O)O[C@H]1C=CC2=CC(=O)C(O)=C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C21H26O4/c1-5-14(2)8-6-7-9-20(24)25-19-11-10-16-12-17(22)18(23)13-21(16,4)15(19)3/h6-15,19,23H,5H2,1-4H3/b8-6+,9-7+/t14-,15-,19-,21+/m0/s1 |
| InChIKey | XIQRWECUXAGJNR-ZAZMLDPXSA-N |
| XLogP | 4.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|