C23H36F2O5 — CID 15200560
propan-2-yl (E)-7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooctyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoate (PubChem CID 15200560) has the molecular formula C23H36F2O5 and a molecular weight of 430.53 g/mol. Its IUPAC name is propan-2-yl (E)-7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooctyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (E)-7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooctyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 15200560 |
| Molecular Formula | C23H36F2O5 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | propan-2-yl (E)-7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooctyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCC(F)(F)C(=O)CCC[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C/CCCC(=O)OC(C)C |
| InChI | InChI=1S/C23H36F2O5/c1-4-14-23(24,25)21(28)12-9-11-18-17(19(26)15-20(18)27)10-7-5-6-8-13-22(29)30-16(2)3/h5,7,16-18,20,27H,4,6,8-15H2,1-3H3/b7-5+/t17-,18-,20-/m1/s1 |
| InChIKey | CQJCZHUNKJHUHN-SIZYHBSMSA-N |
| XLogP | 4.80 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|