C22H34F2O4 — CID 15200561
methyl (Z)-7-[(1R,2S,3R)-2-(5,5-difluoro-4-oxooctyl)-3-methyl-5-oxocyclopentyl]hept-5-enoate (PubChem CID 15200561) has the molecular formula C22H34F2O4 and a molecular weight of 400.51 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S,3R)-2-(5,5-difluoro-4-oxooctyl)-3-methyl-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S,3R)-2-(5,5-difluoro-4-oxooctyl)-3-methyl-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 15200561 |
| Molecular Formula | C22H34F2O4 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | methyl (Z)-7-[(1R,2S,3R)-2-(5,5-difluoro-4-oxooctyl)-3-methyl-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCC(F)(F)C(=O)CCC[C@H]1[C@H](C)CC(=O)[C@@H]1C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C22H34F2O4/c1-4-14-22(23,24)20(26)12-9-11-17-16(2)15-19(25)18(17)10-7-5-6-8-13-21(27)28-3/h5,7,16-18H,4,6,8-15H2,1-3H3/b7-5-/t16-,17+,18-/m1/s1 |
| InChIKey | GPRZCRZUAAKEQA-IEANYPGHSA-N |
| XLogP | 5.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|