C21H34F2O5 — CID 15200565
methyl 7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoate (PubChem CID 15200565) has the molecular formula C21H34F2O5 and a molecular weight of 404.49 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 15200565 |
| Molecular Formula | C21H34F2O5 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-2-(5,5-difluoro-4-oxooctyl)-3-hydroxy-5-oxocyclopentyl]heptanoate |
| SMILES | CCCC(F)(F)C(=O)CCC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C21H34F2O5/c1-3-13-21(22,23)19(26)11-8-10-16-15(17(24)14-18(16)25)9-6-4-5-7-12-20(27)28-2/h15-16,18,25H,3-14H2,1-2H3/t15-,16-,18-/m1/s1 |
| InChIKey | OJBNBTKPGFWPFT-JFIYKMOQSA-N |
| XLogP | 4.24 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|