C21H34F2O5 — CID 15200566
methyl (Z)-7-[(1R,2R,3R,5S)-2-(5,5-difluoro-4-oxooctyl)-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 15200566) has the molecular formula C21H34F2O5 and a molecular weight of 404.49 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-2-(5,5-difluoro-4-oxooctyl)-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-2-(5,5-difluoro-4-oxooctyl)-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 15200566 |
| Molecular Formula | C21H34F2O5 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-2-(5,5-difluoro-4-oxooctyl)-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | CCCC(F)(F)C(=O)CCC[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C21H34F2O5/c1-3-13-21(22,23)19(26)11-8-10-16-15(17(24)14-18(16)25)9-6-4-5-7-12-20(27)28-2/h4,6,15-18,24-25H,3,5,7-14H2,1-2H3/b6-4-/t15-,16-,17+,18-/m1/s1 |
| InChIKey | LUXPZVOKILJYFK-RRJWWHKXSA-N |
| XLogP | 3.81 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|