C21H32F2O5 — CID 15200568
methyl (Z)-7-[(1R,2R,5S)-2-(5,5-difluoro-4-oxooctyl)-5-hydroxy-3-oxocyclopentyl]hept-5-enoate (PubChem CID 15200568) has the molecular formula C21H32F2O5 and a molecular weight of 402.48 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,5S)-2-(5,5-difluoro-4-oxooctyl)-5-hydroxy-3-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,5S)-2-(5,5-difluoro-4-oxooctyl)-5-hydroxy-3-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 15200568 |
| Molecular Formula | C21H32F2O5 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,5S)-2-(5,5-difluoro-4-oxooctyl)-5-hydroxy-3-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCC(F)(F)C(=O)CCC[C@H]1C(=O)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C21H32F2O5/c1-3-13-21(22,23)19(26)11-8-10-16-15(17(24)14-18(16)25)9-6-4-5-7-12-20(27)28-2/h4,6,15-17,24H,3,5,7-14H2,1-2H3/b6-4-/t15-,16-,17+/m1/s1 |
| InChIKey | BVUYITMDHDJBKZ-BAGCBANVSA-N |
| XLogP | 4.02 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|