C23H27NO4 — CID 15200727
(3Z)-3-[1-(1,2-dimethylindol-3-yl)ethylidene]-4-propan-2-ylidene-1,6-dioxecane-2,5-dione (PubChem CID 15200727) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (3Z)-3-[1-(1,2-dimethylindol-3-yl)ethylidene]-4-propan-2-ylidene-1,6-dioxecane-2,5-dione.
| Compound Name | (3Z)-3-[1-(1,2-dimethylindol-3-yl)ethylidene]-4-propan-2-ylidene-1,6-dioxecane-2,5-dione |
|---|---|
| PubChem CID | 15200727 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (3Z)-3-[1-(1,2-dimethylindol-3-yl)ethylidene]-4-propan-2-ylidene-1,6-dioxecane-2,5-dione |
| SMILES | CC(C)=C1C(=O)OCCCCOC(=O)/C1=C(/C)c1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C23H27NO4/c1-14(2)19-21(23(26)28-13-9-8-12-27-22(19)25)15(3)20-16(4)24(5)18-11-7-6-10-17(18)20/h6-7,10-11H,8-9,12-13H2,1-5H3/b21-15- |
| InChIKey | ZCKMDNLDZQBOLQ-QNGOZBTKSA-N |
| XLogP | 4.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|