About 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane
3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane (PubChem CID 15201166) has the molecular formula C16H21ClOSe
and a molecular weight of 343.76 g/mol. Its IUPAC name is 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane.
Molecular Properties
| Compound Name | 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane |
| PubChem CID | 15201166 |
| Molecular Formula | C16H21ClOSe |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane |
| SMILES | CC1(C)C2CCC13C[Se](Cl)(c1ccccc1)OC3C2 |
| InChI | InChI=1S/C16H21ClOSe/c1-15(2)12-8-9-16(15)11-19(17,18-14(16)10-12)13-6-4-3-5-7-13/h3-7,12,14H,8-11H2,1-2H3 |
| InChIKey | QWLIGONOTNFSAS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane?
The IUPAC name of 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane (CID 15201166) is 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane.
What is the SMILES notation for 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane?
The canonical SMILES for 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane is CC1(C)C2CCC13C[Se](Cl)(c1ccccc1)OC3C2.
What is the InChIKey of 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane?
The InChIKey is QWLIGONOTNFSAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClOSe/c1-15(2)12-8-9-16(15)11-19(17,18-14(16)10-12)13-6-4-3-5-7-13/h3-7,12,14H,8-11H2,1-2H3.
What are the key properties of 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane?
3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane has a molecular weight of 343.76 g/mol, XLogP of 3.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane is sourced from PubChem (CID 15201166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).