C16H21ClOSe — CID 15201167
(1S,5R,7R)-3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane (PubChem CID 15201167) has the molecular formula C16H21ClOSe and a molecular weight of 343.76 g/mol. Its IUPAC name is (1S,5R,7R)-3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane.
| Compound Name | (1S,5R,7R)-3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane |
|---|---|
| PubChem CID | 15201167 |
| Molecular Formula | C16H21ClOSe |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | (1S,5R,7R)-3-chloro-10,10-dimethyl-3-phenyl-4-oxa-3lambda4-selenatricyclo[5.2.1.01,5]decane |
| SMILES | CC1(C)[C@@H]2CC[C@]13C[Se@@](Cl)(c1ccccc1)O[C@@H]3C2 |
| InChI | InChI=1S/C16H21ClOSe/c1-15(2)12-8-9-16(15)11-19(17,18-14(16)10-12)13-6-4-3-5-7-13/h3-7,12,14H,8-11H2,1-2H3/t12-,14-,16-/m1/s1 |
| InChIKey | QWLIGONOTNFSAS-XNRPHZJLSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|