C16H21NO2 — CID 15202060
tert-butyl 6-phenyl-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 15202060) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is tert-butyl 6-phenyl-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-phenyl-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 15202060 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | tert-butyl 6-phenyl-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC=C1c1ccccc1 |
| InChI | InChI=1S/C16H21NO2/c1-16(2,3)19-15(18)17-12-8-7-11-14(17)13-9-5-4-6-10-13/h4-6,9-11H,7-8,12H2,1-3H3 |
| InChIKey | FZFOZJKBMLXIQS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |