C16H34O3Si — CID 15202437
(4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5,7-dimethyloctan-2-one (PubChem CID 15202437) has the molecular formula C16H34O3Si and a molecular weight of 302.53 g/mol. Its IUPAC name is (4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5,7-dimethyloctan-2-one.
| Compound Name | (4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5,7-dimethyloctan-2-one |
|---|---|
| PubChem CID | 15202437 |
| Molecular Formula | C16H34O3Si |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | (4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5,7-dimethyloctan-2-one |
| SMILES | CC(=O)C[C@@H](O)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H34O3Si/c1-11(2)15(13(4)14(18)10-12(3)17)19-20(8,9)16(5,6)7/h11,13-15,18H,10H2,1-9H3/t13-,14+,15+/m0/s1 |
| InChIKey | CFORFRBCZCYLDX-RRFJBIMHSA-N |
| XLogP | 4.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|