About 1,1-dimethyl-2,3-dihydropyrrol-1-ium
1,1-dimethyl-2,3-dihydropyrrol-1-ium (PubChem CID 15202843) has the molecular formula C6H12N+
and a molecular weight of 98.17 g/mol. Its IUPAC name is 1,1-dimethyl-2,3-dihydropyrrol-1-ium.
Molecular Properties
| Compound Name | 1,1-dimethyl-2,3-dihydropyrrol-1-ium |
| PubChem CID | 15202843 |
| Molecular Formula | C6H12N+ |
| Molecular Weight | 98.17 g/mol |
| Exact Mass | 98.10 |
| IUPAC Name | 1,1-dimethyl-2,3-dihydropyrrol-1-ium |
| SMILES | C[N+]1(C)C=CCC1 |
| InChI | InChI=1S/C6H12N/c1-7(2)5-3-4-6-7/h3,5H,4,6H2,1-2H3/q+1 |
| InChIKey | IIPZFKPTBXDQSG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-2,3-dihydropyrrol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-2,3-dihydropyrrol-1-ium?
The IUPAC name of 1,1-dimethyl-2,3-dihydropyrrol-1-ium (CID 15202843) is 1,1-dimethyl-2,3-dihydropyrrol-1-ium.
What is the SMILES notation for 1,1-dimethyl-2,3-dihydropyrrol-1-ium?
The canonical SMILES for 1,1-dimethyl-2,3-dihydropyrrol-1-ium is C[N+]1(C)C=CCC1.
What is the InChIKey of 1,1-dimethyl-2,3-dihydropyrrol-1-ium?
The InChIKey is IIPZFKPTBXDQSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N/c1-7(2)5-3-4-6-7/h3,5H,4,6H2,1-2H3/q+1.
What are the key properties of 1,1-dimethyl-2,3-dihydropyrrol-1-ium?
1,1-dimethyl-2,3-dihydropyrrol-1-ium has a molecular weight of 98.17 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-2,3-dihydropyrrol-1-ium is sourced from PubChem (CID 15202843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).