About (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid
(2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid (PubChem CID 15202858) has the molecular formula C5H5NO3
and a molecular weight of 127.10 g/mol. Its IUPAC name is (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid |
| PubChem CID | 15202858 |
| Molecular Formula | C5H5NO3 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.03 |
| IUPAC Name | (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid |
| SMILES | O=C1C=C[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C5H5NO3/c7-4-2-1-3(6-4)5(8)9/h1-3H,(H,6,7)(H,8,9)/t3-/m0/s1 |
| InChIKey | BAQXAKWDKIIPEC-VKHMYHEASA-N |
| XLogP | -0.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid?
The IUPAC name of (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid (CID 15202858) is (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid.
What is the SMILES notation for (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid?
The canonical SMILES for (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid is O=C1C=C[C@@H](C(=O)O)N1.
What is the InChIKey of (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid?
The InChIKey is BAQXAKWDKIIPEC-VKHMYHEASA-N. The full InChI is InChI=1S/C5H5NO3/c7-4-2-1-3(6-4)5(8)9/h1-3H,(H,6,7)(H,8,9)/t3-/m0/s1.
What are the key properties of (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid?
(2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid has a molecular weight of 127.10 g/mol, XLogP of -0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-oxo-1,2-dihydropyrrole-2-carboxylic acid is sourced from PubChem (CID 15202858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).