About 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one
2-(hydroxymethyl)-1,2-dihydropyrrol-5-one (PubChem CID 15202861) has the molecular formula C5H7NO2
and a molecular weight of 113.12 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one |
| PubChem CID | 15202861 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one |
| SMILES | O=C1C=CC(CO)N1 |
| InChI | InChI=1S/C5H7NO2/c7-3-4-1-2-5(8)6-4/h1-2,4,7H,3H2,(H,6,8) |
| InChIKey | NBOYRYFJJZYGLC-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one?
The IUPAC name of 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one (CID 15202861) is 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one?
The canonical SMILES for 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one is O=C1C=CC(CO)N1.
What is the InChIKey of 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one?
The InChIKey is NBOYRYFJJZYGLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2/c7-3-4-1-2-5(8)6-4/h1-2,4,7H,3H2,(H,6,8).
What are the key properties of 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one?
2-(hydroxymethyl)-1,2-dihydropyrrol-5-one has a molecular weight of 113.12 g/mol, XLogP of -0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 15202861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).