About methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate
methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate (PubChem CID 15202875) has the molecular formula C16H26O3Si
and a molecular weight of 294.47 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
| PubChem CID | 15202875 |
| Molecular Formula | C16H26O3Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
| SMILES | COC(=O)C1=C(O[Si](C)(C)C(C)(C)C)CC2C=CC1C2 |
| InChI | InChI=1S/C16H26O3Si/c1-16(2,3)20(5,6)19-13-10-11-7-8-12(9-11)14(13)15(17)18-4/h7-8,11-12H,9-10H2,1-6H3 |
| InChIKey | GMYOZPIREONLOL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate?
The IUPAC name of methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate (CID 15202875) is methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate.
What is the SMILES notation for methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate?
The canonical SMILES for methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate is COC(=O)C1=C(O[Si](C)(C)C(C)(C)C)CC2C=CC1C2.
What is the InChIKey of methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate?
The InChIKey is GMYOZPIREONLOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O3Si/c1-16(2,3)20(5,6)19-13-10-11-7-8-12(9-11)14(13)15(17)18-4/h7-8,11-12H,9-10H2,1-6H3.
What are the key properties of methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate?
methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate has a molecular weight of 294.47 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.2.1]octa-2,6-diene-2-carboxylate is sourced from PubChem (CID 15202875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).