About 2-(2,4-dimethylphenyl)oxirane
2-(2,4-dimethylphenyl)oxirane (PubChem CID 15203042) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)oxirane.
Molecular Properties
| Compound Name | 2-(2,4-dimethylphenyl)oxirane |
| PubChem CID | 15203042 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 2-(2,4-dimethylphenyl)oxirane |
| SMILES | Cc1ccc(C2CO2)c(C)c1 |
| InChI | InChI=1S/C10H12O/c1-7-3-4-9(8(2)5-7)10-6-11-10/h3-5,10H,6H2,1-2H3 |
| InChIKey | YPZGLFAPPDVLFY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dimethylphenyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethylphenyl)oxirane?
The IUPAC name of 2-(2,4-dimethylphenyl)oxirane (CID 15203042) is 2-(2,4-dimethylphenyl)oxirane.
What is the SMILES notation for 2-(2,4-dimethylphenyl)oxirane?
The canonical SMILES for 2-(2,4-dimethylphenyl)oxirane is Cc1ccc(C2CO2)c(C)c1.
What is the InChIKey of 2-(2,4-dimethylphenyl)oxirane?
The InChIKey is YPZGLFAPPDVLFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-7-3-4-9(8(2)5-7)10-6-11-10/h3-5,10H,6H2,1-2H3.
What are the key properties of 2-(2,4-dimethylphenyl)oxirane?
2-(2,4-dimethylphenyl)oxirane has a molecular weight of 148.20 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylphenyl)oxirane is sourced from PubChem (CID 15203042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).