About (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal
(Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal (PubChem CID 15203311) has the molecular formula C10H9ClO
and a molecular weight of 180.63 g/mol. Its IUPAC name is (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal.
Molecular Properties
| Compound Name | (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal |
| PubChem CID | 15203311 |
| Molecular Formula | C10H9ClO |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal |
| SMILES | O=C/C=C(\Cl)C1=CC=CC=CC1 |
| InChI | InChI=1S/C10H9ClO/c11-10(7-8-12)9-5-3-1-2-4-6-9/h1-5,7-8H,6H2/b10-7- |
| InChIKey | HLTPVTYLPPPEKZ-YFHOEESVSA-N |
| XLogP | 2.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal?
The IUPAC name of (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal (CID 15203311) is (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal.
What is the SMILES notation for (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal?
The canonical SMILES for (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal is O=C/C=C(\Cl)C1=CC=CC=CC1.
What is the InChIKey of (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal?
The InChIKey is HLTPVTYLPPPEKZ-YFHOEESVSA-N. The full InChI is InChI=1S/C10H9ClO/c11-10(7-8-12)9-5-3-1-2-4-6-9/h1-5,7-8H,6H2/b10-7-.
What are the key properties of (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal?
(Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal has a molecular weight of 180.63 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-chloro-3-cyclohepta-1,3,5-trien-1-ylprop-2-enal is sourced from PubChem (CID 15203311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).