C20H30O4S2 — CID 15203391
(1R,3S,6R,8S)-4,5-bis(tert-butylsulfonyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene (PubChem CID 15203391) has the molecular formula C20H30O4S2 and a molecular weight of 398.59 g/mol. Its IUPAC name is (1R,3S,6R,8S)-4,5-bis(tert-butylsulfonyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene.
| Compound Name | (1R,3S,6R,8S)-4,5-bis(tert-butylsulfonyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene |
|---|---|
| PubChem CID | 15203391 |
| Molecular Formula | C20H30O4S2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (1R,3S,6R,8S)-4,5-bis(tert-butylsulfonyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene |
| SMILES | CC(C)(C)S(=O)(=O)C1=C(S(=O)(=O)C(C)(C)C)[C@H]2C[C@@H]1C1=C2[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C20H30O4S2/c1-19(2,3)25(21,22)17-13-10-14(18(17)26(23,24)20(4,5)6)16-12-8-7-11(9-12)15(13)16/h11-14H,7-10H2,1-6H3/t11-,12+,13+,14- |
| InChIKey | LETGPBPORDEDTC-LVEBTZEWSA-N |
| XLogP | 4.00 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|