About 2-ethoxy-N-methyl-2-oxoethanimine oxide
2-ethoxy-N-methyl-2-oxoethanimine oxide (PubChem CID 15203489) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is 2-ethoxy-N-methyl-2-oxoethanimine oxide.
Molecular Properties
| Compound Name | 2-ethoxy-N-methyl-2-oxoethanimine oxide |
| PubChem CID | 15203489 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 2-ethoxy-N-methyl-2-oxoethanimine oxide |
| SMILES | CCOC(=O)/C=[N+](/C)[O-] |
| InChI | InChI=1S/C5H9NO3/c1-3-9-5(7)4-6(2)8/h4H,3H2,1-2H3/b6-4- |
| InChIKey | DHVKJXUIAIUEJF-XQRVVYSFSA-N |
| XLogP | -0.24 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-N-methyl-2-oxoethanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N-methyl-2-oxoethanimine oxide?
The IUPAC name of 2-ethoxy-N-methyl-2-oxoethanimine oxide (CID 15203489) is 2-ethoxy-N-methyl-2-oxoethanimine oxide.
What is the SMILES notation for 2-ethoxy-N-methyl-2-oxoethanimine oxide?
The canonical SMILES for 2-ethoxy-N-methyl-2-oxoethanimine oxide is CCOC(=O)/C=[N+](/C)[O-].
What is the InChIKey of 2-ethoxy-N-methyl-2-oxoethanimine oxide?
The InChIKey is DHVKJXUIAIUEJF-XQRVVYSFSA-N. The full InChI is InChI=1S/C5H9NO3/c1-3-9-5(7)4-6(2)8/h4H,3H2,1-2H3/b6-4-.
What are the key properties of 2-ethoxy-N-methyl-2-oxoethanimine oxide?
2-ethoxy-N-methyl-2-oxoethanimine oxide has a molecular weight of 131.13 g/mol, XLogP of -0.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N-methyl-2-oxoethanimine oxide is sourced from PubChem (CID 15203489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).