C6H12F3NO — CID 15203565
(2R,3R)-2-amino-1,1,1-trifluoro-4-methylpentan-3-ol (PubChem CID 15203565) has the molecular formula C6H12F3NO and a molecular weight of 171.16 g/mol. Its IUPAC name is (2R,3R)-2-amino-1,1,1-trifluoro-4-methylpentan-3-ol.
| Compound Name | (2R,3R)-2-amino-1,1,1-trifluoro-4-methylpentan-3-ol |
|---|---|
| PubChem CID | 15203565 |
| Molecular Formula | C6H12F3NO |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (2R,3R)-2-amino-1,1,1-trifluoro-4-methylpentan-3-ol |
| SMILES | CC(C)[C@@H](O)[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C6H12F3NO/c1-3(2)4(11)5(10)6(7,8)9/h3-5,11H,10H2,1-2H3/t4-,5-/m1/s1 |
| InChIKey | MURXETOSGABWGV-RFZPGFLSSA-N |
| XLogP | 0.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |