C18H24O4 — CID 15203721
(2R,4aR,6S,7R,8aS)-6-(3-methylbut-3-enyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 15203721) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8aS)-6-(3-methylbut-3-enyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (2R,4aR,6S,7R,8aS)-6-(3-methylbut-3-enyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 15203721 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (2R,4aR,6S,7R,8aS)-6-(3-methylbut-3-enyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | C=C(C)CC[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C18H24O4/c1-12(2)8-9-15-14(19)10-16-17(21-15)11-20-18(22-16)13-6-4-3-5-7-13/h3-7,14-19H,1,8-11H2,2H3/t14-,15+,16+,17-,18-/m1/s1 |
| InChIKey | CIRJLBBRHVWVLN-DISONHOPSA-N |
| XLogP | 2.98 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|