C13H22O2 — CID 15204010
(2R)-2-octyl-2,3-dihydropyran-4-one (PubChem CID 15204010) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (2R)-2-octyl-2,3-dihydropyran-4-one.
| Compound Name | (2R)-2-octyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 15204010 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (2R)-2-octyl-2,3-dihydropyran-4-one |
| SMILES | CCCCCCCC[C@@H]1CC(=O)C=CO1 |
| InChI | InChI=1S/C13H22O2/c1-2-3-4-5-6-7-8-13-11-12(14)9-10-15-13/h9-10,13H,2-8,11H2,1H3/t13-/m1/s1 |
| InChIKey | UKJVOAVIMBRFSQ-CYBMUJFWSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|