C24H24N4 — CID 15204492
1,6,11,16-tetrazatricyclo[14.4.4.46,11]octacosa-3,8,13,18,22,26-hexayne (PubChem CID 15204492) has the molecular formula C24H24N4 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1,6,11,16-tetrazatricyclo[14.4.4.46,11]octacosa-3,8,13,18,22,26-hexayne.
| Compound Name | 1,6,11,16-tetrazatricyclo[14.4.4.46,11]octacosa-3,8,13,18,22,26-hexayne |
|---|---|
| PubChem CID | 15204492 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1,6,11,16-tetrazatricyclo[14.4.4.46,11]octacosa-3,8,13,18,22,26-hexayne |
| SMILES | C1#CCN2CC#CCN(C1)CC#CCN1CC#CCN(CC#CC1)CC#CC2 |
| InChI | InChI=1S/C24H24N4/c1-2-14-26-16-4-3-15-25(13-1)21-9-10-23-27-17-5-7-19-28(20-8-6-18-27)24-12-11-22-26/h13-24H2 |
| InChIKey | IQVKFCLISOWCHK-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|